C25H23FN2O2 — CID 44579236
4-fluoro-N-[2-oxo-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)ethyl]benzamide (PubChem CID 44579236) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is 4-fluoro-N-[2-oxo-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-oxo-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 44579236 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-fluoro-N-[2-oxo-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)NCC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C25H23FN2O2/c26-20-13-11-19(12-14-20)25(30)28-16-24(29)27-15-23-21-7-3-1-5-17(21)9-10-18-6-2-4-8-22(18)23/h1-8,11-14,23H,9-10,15-16H2,(H,27,29)(H,28,30) |
| InChIKey | WDADGFYGRSIPGG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |