About N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine
N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine (PubChem CID 44579447) has the molecular formula C23H22N4
and a molecular weight of 354.46 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine |
| PubChem CID | 44579447 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine |
| SMILES | C(=C/c1ccccc1)\CCN(Cc1cccc2ccccc12)n1cnnc1 |
| InChI | InChI=1S/C23H22N4/c1-2-9-20(10-3-1)11-6-7-16-26(27-18-24-25-19-27)17-22-14-8-13-21-12-4-5-15-23(21)22/h1-6,8-15,18-19H,7,16-17H2/b11-6+ |
| InChIKey | WJQWJLIPIBRMSI-IZZDOVSWSA-N |
| XLogP | 4.67 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine?
The IUPAC name of N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine (CID 44579447) is N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine.
What is the SMILES notation for N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine?
The canonical SMILES for N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine is C(=C/c1ccccc1)\CCN(Cc1cccc2ccccc12)n1cnnc1.
What is the InChIKey of N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine?
The InChIKey is WJQWJLIPIBRMSI-IZZDOVSWSA-N. The full InChI is InChI=1S/C23H22N4/c1-2-9-20(10-3-1)11-6-7-16-26(27-18-24-25-19-27)17-22-14-8-13-21-12-4-5-15-23(21)22/h1-6,8-15,18-19H,7,16-17H2/b11-6+.
What are the key properties of N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine?
N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine has a molecular weight of 354.46 g/mol, XLogP of 4.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(naphthalen-1-ylmethyl)-N-[(E)-4-phenylbut-3-enyl]-1,2,4-triazol-4-amine is sourced from PubChem (CID 44579447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).