C19H15FN2O5S — CID 44579541
3-amino-N-[4-fluoro-3-(5-hydroxy-1,3-benzodioxol-4-yl)phenyl]benzenesulfonamide (PubChem CID 44579541) has the molecular formula C19H15FN2O5S and a molecular weight of 402.40 g/mol. Its IUPAC name is 3-amino-N-[4-fluoro-3-(5-hydroxy-1,3-benzodioxol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 3-amino-N-[4-fluoro-3-(5-hydroxy-1,3-benzodioxol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44579541 |
| Molecular Formula | C19H15FN2O5S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3-amino-N-[4-fluoro-3-(5-hydroxy-1,3-benzodioxol-4-yl)phenyl]benzenesulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)Nc2ccc(F)c(-c3c(O)ccc4c3OCO4)c2)c1 |
| InChI | InChI=1S/C19H15FN2O5S/c20-15-5-4-12(22-28(24,25)13-3-1-2-11(21)8-13)9-14(15)18-16(23)6-7-17-19(18)27-10-26-17/h1-9,22-23H,10,21H2 |
| InChIKey | UDOBZKFDTAISGE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|