About 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole
3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole (PubChem CID 44580289) has the molecular formula C17H16ClFN4O
and a molecular weight of 346.79 g/mol. Its IUPAC name is 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole |
| PubChem CID | 44580289 |
| Molecular Formula | C17H16ClFN4O |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole |
| SMILES | Fc1ccc(-c2cc(-c3cnn(C4CCNCC4)c3)on2)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClFN4O/c18-15-7-12(19)1-2-14(15)16-8-17(24-22-16)11-9-21-23(10-11)13-3-5-20-6-4-13/h1-2,7-10,13,20H,3-6H2 |
| InChIKey | GRTMAMUATTYINL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole?
The IUPAC name of 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole (CID 44580289) is 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole.
What is the SMILES notation for 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole?
The canonical SMILES for 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole is Fc1ccc(-c2cc(-c3cnn(C4CCNCC4)c3)on2)c(Cl)c1.
What is the InChIKey of 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole?
The InChIKey is GRTMAMUATTYINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClFN4O/c18-15-7-12(19)1-2-14(15)16-8-17(24-22-16)11-9-21-23(10-11)13-3-5-20-6-4-13/h1-2,7-10,13,20H,3-6H2.
What are the key properties of 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole?
3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole has a molecular weight of 346.79 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4-fluorophenyl)-5-(1-piperidin-4-ylpyrazol-4-yl)-1,2-oxazole is sourced from PubChem (CID 44580289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).