C23H33NO3 — CID 44580652
(1R,4aS,10aR)-1,4a-dimethyl-6-(propanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 44580652) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-6-(propanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(propanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 44580652 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-6-(propanoylamino)-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CCC(=O)Nc1cc2c(cc1C(C)C)CC[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C23H33NO3/c1-6-20(25)24-18-13-17-15(12-16(18)14(2)3)8-9-19-22(17,4)10-7-11-23(19,5)21(26)27/h12-14,19H,6-11H2,1-5H3,(H,24,25)(H,26,27)/t19-,22-,23-/m1/s1 |
| InChIKey | MUYKEJMEIIKNHZ-UEVCKROQSA-N |
| XLogP | 5.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |