C20H29NO3S2 — CID 44581589
(2R)-3-[(4-cyclohexylphenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 44581589) has the molecular formula C20H29NO3S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (2R)-3-[(4-cyclohexylphenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-[(4-cyclohexylphenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44581589 |
| Molecular Formula | C20H29NO3S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2R)-3-[(4-cyclohexylphenyl)methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | C[C@H](CS)C(=O)N[C@@H](CSCc1ccc(C2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C20H29NO3S2/c1-14(11-25)19(22)21-18(20(23)24)13-26-12-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h7-10,14,16,18,25H,2-6,11-13H2,1H3,(H,21,22)(H,23,24)/t14-,18+/m1/s1 |
| InChIKey | SVLSVKUAIUBCEK-KDOFPFPSSA-N |
| XLogP | 4.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|