C14H18N2O5S2 — CID 44581658
(2R)-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]-3-[(4-nitrophenyl)methylsulfanyl]propanoic acid (PubChem CID 44581658) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]-3-[(4-nitrophenyl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]-3-[(4-nitrophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 44581658 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (2R)-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]-3-[(4-nitrophenyl)methylsulfanyl]propanoic acid |
| SMILES | C[C@H](CS)C(=O)N[C@@H](CSCc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C14H18N2O5S2/c1-9(6-22)13(17)15-12(14(18)19)8-23-7-10-2-4-11(5-3-10)16(20)21/h2-5,9,12,22H,6-8H2,1H3,(H,15,17)(H,18,19)/t9-,12+/m1/s1 |
| InChIKey | LMWXKJGGEYQKHD-SKDRFNHKSA-N |
| XLogP | 1.96 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|