C12H12N2O7S — CID 56684140
(2R)-3-[(3-nitrophenyl)methylsulfanyl]-2-(oxaloamino)propanoic acid (PubChem CID 56684140) has the molecular formula C12H12N2O7S and a molecular weight of 328.30 g/mol. Its IUPAC name is (2R)-3-[(3-nitrophenyl)methylsulfanyl]-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-[(3-nitrophenyl)methylsulfanyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 56684140 |
| Molecular Formula | C12H12N2O7S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (2R)-3-[(3-nitrophenyl)methylsulfanyl]-2-(oxaloamino)propanoic acid |
| SMILES | O=C(O)C(=O)N[C@@H](CSCc1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C12H12N2O7S/c15-10(12(18)19)13-9(11(16)17)6-22-5-7-2-1-3-8(4-7)14(20)21/h1-4,9H,5-6H2,(H,13,15)(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | OBSYIMVMIJBTMQ-VIFPVBQESA-N |
| XLogP | 0.48 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|