C16H24ClN3O3 — CID 44582226
1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(2-morpholin-4-ylethyl)urea (PubChem CID 44582226) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is 1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 44582226 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(2-morpholin-4-ylethyl)urea |
| SMILES | CN(C)C(=O)N(CCN1CCOCC1)Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H24ClN3O3/c1-18(2)16(22)20(6-5-19-7-9-23-10-8-19)12-13-11-14(17)3-4-15(13)21/h3-4,11,21H,5-10,12H2,1-2H3 |
| InChIKey | QLDXCFVFCVQFEG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|