C17H26ClN3O3 — CID 44582227
1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(3-morpholin-4-ylpropyl)urea (PubChem CID 44582227) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 44582227 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[(5-chloro-2-hydroxyphenyl)methyl]-3,3-dimethyl-1-(3-morpholin-4-ylpropyl)urea |
| SMILES | CN(C)C(=O)N(CCCN1CCOCC1)Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H26ClN3O3/c1-19(2)17(23)21(7-3-6-20-8-10-24-11-9-20)13-14-12-15(18)4-5-16(14)22/h4-5,12,22H,3,6-11,13H2,1-2H3 |
| InChIKey | CCMXNTRVUNPHGP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|