C16H12N4O4 — CID 44582697
4-acetyl-N-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]benzamide (PubChem CID 44582697) has the molecular formula C16H12N4O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is 4-acetyl-N-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]benzamide.
| Compound Name | 4-acetyl-N-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44582697 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-acetyl-N-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]benzamide |
| SMILES | CC(=O)c1ccc(C(=O)N/N=C/c2ccc3c(c2)no[n+]3[O-])cc1 |
| InChI | InChI=1S/C16H12N4O4/c1-10(21)12-3-5-13(6-4-12)16(22)18-17-9-11-2-7-15-14(8-11)19-24-20(15)23/h2-9H,1H3,(H,18,22)/b17-9+ |
| InChIKey | ICTATBHUOIZGJG-RQZCQDPDSA-N |
| XLogP | 1.43 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|