C14H19N5O3 — CID 10662350
1-hexyl-3-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]urea (PubChem CID 10662350) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-hexyl-3-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]urea.
| Compound Name | 1-hexyl-3-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 10662350 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-hexyl-3-[(E)-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-yl)methylideneamino]urea |
| SMILES | CCCCCCNC(=O)N/N=C/c1ccc2c(c1)no[n+]2[O-] |
| InChI | InChI=1S/C14H19N5O3/c1-2-3-4-5-8-15-14(20)17-16-10-11-6-7-13-12(9-11)18-22-19(13)21/h6-7,9-10H,2-5,8H2,1H3,(H2,15,17,20)/b16-10+ |
| InChIKey | VTEIIRJGJUZZMD-MHWRWJLKSA-N |
| XLogP | 1.67 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|