C22H16N2O4 — CID 44582836
3-(1-benzofuran-3-yl)-4-[7-(hydroxymethyl)-1-methylindol-3-yl]pyrrole-2,5-dione (PubChem CID 44582836) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-4-[7-(hydroxymethyl)-1-methylindol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-benzofuran-3-yl)-4-[7-(hydroxymethyl)-1-methylindol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 44582836 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-4-[7-(hydroxymethyl)-1-methylindol-3-yl]pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3coc4ccccc34)C(=O)NC2=O)c2cccc(CO)c21 |
| InChI | InChI=1S/C22H16N2O4/c1-24-9-15(14-7-4-5-12(10-25)20(14)24)18-19(22(27)23-21(18)26)16-11-28-17-8-3-2-6-13(16)17/h2-9,11,25H,10H2,1H3,(H,23,26,27) |
| InChIKey | QHRXZUMETMHYMU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|