C12H16BrClO — CID 44583723
4-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran (PubChem CID 44583723) has the molecular formula C12H16BrClO and a molecular weight of 291.62 g/mol. Its IUPAC name is 4-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran.
| Compound Name | 4-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran |
|---|---|
| PubChem CID | 44583723 |
| Molecular Formula | C12H16BrClO |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 4-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran |
| SMILES | Cc1cc([C@H]2CC[C@](C)(Cl)[C@@H](Br)C2)co1 |
| InChI | InChI=1S/C12H16BrClO/c1-8-5-10(7-15-8)9-3-4-12(2,14)11(13)6-9/h5,7,9,11H,3-4,6H2,1-2H3/t9-,11-,12-/m0/s1 |
| InChIKey | SSNOXKUJPSHPSX-DLOVCJGASA-N |
| XLogP | 4.62 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|