C13H23NO4 — CID 44585251
(2R,3S,4S,5R)-2-[[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 44585251) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-[[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44585251 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (2R,3S,4S,5R)-2-[[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@H](CN[C@@H]2C[C@@H]3CC[C@@H]2C3)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO4/c15-6-11-13(17)12(16)10(18-11)5-14-9-4-7-1-2-8(9)3-7/h7-17H,1-6H2/t7-,8-,9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | AIBZRMYQKMMGMS-VALWXPLLSA-N |
| XLogP | -0.75 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |