C26H30N4O4 — CID 44586133
N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-phenoxypyridine-3-carboxamide (PubChem CID 44586133) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-phenoxypyridine-3-carboxamide.
| Compound Name | N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-phenoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 44586133 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-phenoxypyridine-3-carboxamide |
| SMILES | COc1ccccc1N1CCN(CC(O)CNC(=O)c2cccnc2Oc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N4O4/c1-33-24-12-6-5-11-23(24)30-16-14-29(15-17-30)19-20(31)18-28-25(32)22-10-7-13-27-26(22)34-21-8-3-2-4-9-21/h2-13,20,31H,14-19H2,1H3,(H,28,32) |
| InChIKey | UPWYSGZTXQQKQO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |