C22H30N2O2 — CID 44589284
1-(2,6-diethylphenyl)-3-[3-(2-ethoxyphenyl)propyl]urea (PubChem CID 44589284) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[3-(2-ethoxyphenyl)propyl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[3-(2-ethoxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 44589284 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[3-(2-ethoxyphenyl)propyl]urea |
| SMILES | CCOc1ccccc1CCCNC(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C22H30N2O2/c1-4-17-12-9-13-18(5-2)21(17)24-22(25)23-16-10-14-19-11-7-8-15-20(19)26-6-3/h7-9,11-13,15H,4-6,10,14,16H2,1-3H3,(H2,23,24,25) |
| InChIKey | YSMUIKUMVKUDLS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|