C22H28FN3O — CID 44589879
(3R)-3-amino-4-(2-fluorophenyl)-N-(1-methyl-4-phenylpiperidin-4-yl)butanamide (PubChem CID 44589879) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is (3R)-3-amino-4-(2-fluorophenyl)-N-(1-methyl-4-phenylpiperidin-4-yl)butanamide.
| Compound Name | (3R)-3-amino-4-(2-fluorophenyl)-N-(1-methyl-4-phenylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 44589879 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3R)-3-amino-4-(2-fluorophenyl)-N-(1-methyl-4-phenylpiperidin-4-yl)butanamide |
| SMILES | CN1CCC(NC(=O)C[C@H](N)Cc2ccccc2F)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28FN3O/c1-26-13-11-22(12-14-26,18-8-3-2-4-9-18)25-21(27)16-19(24)15-17-7-5-6-10-20(17)23/h2-10,19H,11-16,24H2,1H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | DEZTZZCXVQYIRV-LJQANCHMSA-N |
| XLogP | 2.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |