C26H33N3O2 — CID 44590277
10-[2-hydroxy-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acridin-9-one (PubChem CID 44590277) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 10-[2-hydroxy-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acridin-9-one.
| Compound Name | 10-[2-hydroxy-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acridin-9-one |
|---|---|
| PubChem CID | 44590277 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 10-[2-hydroxy-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]acridin-9-one |
| SMILES | O=c1c2ccccc2n(CC(O)CN2CCC(N3CCCCC3)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H33N3O2/c30-21(18-27-16-12-20(13-17-27)28-14-6-1-7-15-28)19-29-24-10-4-2-8-22(24)26(31)23-9-3-5-11-25(23)29/h2-5,8-11,20-21,30H,1,6-7,12-19H2 |
| InChIKey | IFGBRQCKHUVSIA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|