C37H37N3O2S — CID 44591076
2-[1-(4,4-diphenylpiperidin-1-yl)-1-oxohexan-2-yl]sulfanyl-3-phenylquinazolin-4-one (PubChem CID 44591076) has the molecular formula C37H37N3O2S and a molecular weight of 587.79 g/mol. Its IUPAC name is 2-[1-(4,4-diphenylpiperidin-1-yl)-1-oxohexan-2-yl]sulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-(4,4-diphenylpiperidin-1-yl)-1-oxohexan-2-yl]sulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 44591076 |
| Molecular Formula | C37H37N3O2S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 2-[1-(4,4-diphenylpiperidin-1-yl)-1-oxohexan-2-yl]sulfanyl-3-phenylquinazolin-4-one |
| SMILES | CCCCC(Sc1nc2ccccc2c(=O)n1-c1ccccc1)C(=O)N1CCC(c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C37H37N3O2S/c1-2-3-23-33(43-36-38-32-22-14-13-21-31(32)34(41)40(36)30-19-11-6-12-20-30)35(42)39-26-24-37(25-27-39,28-15-7-4-8-16-28)29-17-9-5-10-18-29/h4-22,33H,2-3,23-27H2,1H3 |
| InChIKey | DXGYCOMKUQYCRH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |