C32H35N5O3S — CID 68951477
N-[2-[3-[3-(2-aminophenyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylhexanoyl]piperidine-4-carboxamide (PubChem CID 68951477) has the molecular formula C32H35N5O3S and a molecular weight of 569.73 g/mol. Its IUPAC name is N-[2-[3-[3-(2-aminophenyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylhexanoyl]piperidine-4-carboxamide.
| Compound Name | N-[2-[3-[3-(2-aminophenyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylhexanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 68951477 |
| Molecular Formula | C32H35N5O3S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | N-[2-[3-[3-(2-aminophenyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylhexanoyl]piperidine-4-carboxamide |
| SMILES | CCCCC(Sc1nc2ccccc2c(=O)n1-c1cccc(-c2ccccc2N)c1)C(=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C32H35N5O3S/c1-2-3-15-28(30(39)36-29(38)21-16-18-34-19-17-21)41-32-35-27-14-7-5-12-25(27)31(40)37(32)23-10-8-9-22(20-23)24-11-4-6-13-26(24)33/h4-14,20-21,28,34H,2-3,15-19,33H2,1H3,(H,36,38,39) |
| InChIKey | PJKSGBLPHIBLDL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|