C20H19N5O3 — CID 44595406
pyridin-3-ylmethyl N-[[4-[(2-amino-3-pyridinyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 44595406) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[(2-amino-3-pyridinyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[4-[(2-amino-3-pyridinyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 44595406 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-amino-3-pyridinyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Nc1ncccc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H19N5O3/c21-18-17(4-2-10-23-18)25-19(26)16-7-5-14(6-8-16)12-24-20(27)28-13-15-3-1-9-22-11-15/h1-11H,12-13H2,(H2,21,23)(H,24,27)(H,25,26) |
| InChIKey | WFYUGWONEZRIED-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |