C34H51NO4 — CID 44597828
1-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-O-methyl 2,9-dimethyldecanedioate (PubChem CID 44597828) has the molecular formula C34H51NO4 and a molecular weight of 537.79 g/mol. Its IUPAC name is 1-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-O-methyl 2,9-dimethyldecanedioate.
| Compound Name | 1-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-O-methyl 2,9-dimethyldecanedioate |
|---|---|
| PubChem CID | 44597828 |
| Molecular Formula | C34H51NO4 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | 1-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 10-O-methyl 2,9-dimethyldecanedioate |
| SMILES | COC(=O)C(C)CCCCCCC(C)C(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C34H51NO4/c1-24(32(36)38-3)11-6-4-5-7-12-25(2)33(37)39-28-17-16-27-21-31-29-15-8-9-18-34(29,30(27)22-28)19-20-35(31)23-26-13-10-14-26/h16-17,22,24-26,29,31H,4-15,18-21,23H2,1-3H3/t24?,25?,29-,31+,34+/m0/s1 |
| InChIKey | IJADPUQVQVKFSF-YJKYBJRISA-N |
| XLogP | 7.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|