C14H15Cl2NO5S — CID 44602013
methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]propanoate (PubChem CID 44602013) has the molecular formula C14H15Cl2NO5S and a molecular weight of 380.25 g/mol. Its IUPAC name is methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]propanoate.
| Compound Name | methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]propanoate |
|---|---|
| PubChem CID | 44602013 |
| Molecular Formula | C14H15Cl2NO5S |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | methyl (2S)-2-[(4Z)-8,10-dichloro-1,1-dioxo-3,6-dihydro-7,1λ6,2-benzoxathiazonin-2-yl]propanoate |
| SMILES | COC(=O)[C@H](C)N1C/C=C\COc2c(Cl)cc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C14H15Cl2NO5S/c1-9(14(18)21-2)17-5-3-4-6-22-13-11(16)7-10(15)8-12(13)23(17,19)20/h3-4,7-9H,5-6H2,1-2H3/b4-3-/t9-/m0/s1 |
| InChIKey | AIZYLVODENQYBT-TYRPZCRBSA-N |
| XLogP | 2.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|