C53H58O9S — CID 44603946
[(2R,3S,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris[(2,4,6-trimethylbenzoyl)oxy]oxan-2-yl]methyl 2,4,6-trimethylbenzoate (PubChem CID 44603946) has the molecular formula C53H58O9S and a molecular weight of 871.10 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris[(2,4,6-trimethylbenzoyl)oxy]oxan-2-yl]methyl 2,4,6-trimethylbenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris[(2,4,6-trimethylbenzoyl)oxy]oxan-2-yl]methyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 44603946 |
| Molecular Formula | C53H58O9S |
| Molecular Weight | 871.10 g/mol |
| Exact Mass | 870.38 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris[(2,4,6-trimethylbenzoyl)oxy]oxan-2-yl]methyl 2,4,6-trimethylbenzoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](COC(=O)c3c(C)cc(C)cc3C)[C@H](OC(=O)c3c(C)cc(C)cc3C)[C@H](OC(=O)c3c(C)cc(C)cc3C)[C@H]2OC(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C53H58O9S/c1-27-14-16-40(17-15-27)63-53-48(62-52(57)45-38(12)24-31(5)25-39(45)13)47(61-51(56)44-36(10)22-30(4)23-37(44)11)46(60-50(55)43-34(8)20-29(3)21-35(43)9)41(59-53)26-58-49(54)42-32(6)18-28(2)19-33(42)7/h14-25,41,46-48,53H,26H2,1-13H3/t41-,46+,47+,48-,53+/m1/s1 |
| InChIKey | BDPCBNMCOSNQAP-JKBCOVGCSA-N |
| XLogP | 11.05 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.10 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|