C17H24O3 — CID 44605342
(E)-4-[2-(1-hydroxyhexyl)-4-methylphenyl]but-3-enoic acid (PubChem CID 44605342) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (E)-4-[2-(1-hydroxyhexyl)-4-methylphenyl]but-3-enoic acid.
| Compound Name | (E)-4-[2-(1-hydroxyhexyl)-4-methylphenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 44605342 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (E)-4-[2-(1-hydroxyhexyl)-4-methylphenyl]but-3-enoic acid |
| SMILES | CCCCCC(O)c1cc(C)ccc1/C=C/CC(=O)O |
| InChI | InChI=1S/C17H24O3/c1-3-4-5-8-16(18)15-12-13(2)10-11-14(15)7-6-9-17(19)20/h6-7,10-12,16,18H,3-5,8-9H2,1-2H3,(H,19,20)/b7-6+ |
| InChIKey | UPEPIFABRQWHTB-VOTSOKGWSA-N |
| XLogP | 4.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|