C17H23NO2 — CID 162918143
4-[2-[(3R)-3-hydroxyhex-1-enyl]-4-methylphenyl]but-3-enamide (PubChem CID 162918143) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-[2-[(3R)-3-hydroxyhex-1-enyl]-4-methylphenyl]but-3-enamide.
| Compound Name | 4-[2-[(3R)-3-hydroxyhex-1-enyl]-4-methylphenyl]but-3-enamide |
|---|---|
| PubChem CID | 162918143 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-[2-[(3R)-3-hydroxyhex-1-enyl]-4-methylphenyl]but-3-enamide |
| SMILES | CCC[C@@H](O)C=Cc1cc(C)ccc1C=CCC(N)=O |
| InChI | InChI=1S/C17H23NO2/c1-3-5-16(19)11-10-15-12-13(2)8-9-14(15)6-4-7-17(18)20/h4,6,8-12,16,19H,3,5,7H2,1-2H3,(H2,18,20)/t16-/m1/s1 |
| InChIKey | CNNYMGVUSRNOJM-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |