C17H22O3 — CID 162902168
(E)-6-[2-[(E,3R)-3-hydroxybut-1-enyl]-4-methylphenyl]hex-5-enoic acid (PubChem CID 162902168) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-6-[2-[(E,3R)-3-hydroxybut-1-enyl]-4-methylphenyl]hex-5-enoic acid.
| Compound Name | (E)-6-[2-[(E,3R)-3-hydroxybut-1-enyl]-4-methylphenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 162902168 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (E)-6-[2-[(E,3R)-3-hydroxybut-1-enyl]-4-methylphenyl]hex-5-enoic acid |
| SMILES | Cc1ccc(/C=C/CCCC(=O)O)c(/C=C/[C@@H](C)O)c1 |
| InChI | InChI=1S/C17H22O3/c1-13-8-10-15(6-4-3-5-7-17(19)20)16(12-13)11-9-14(2)18/h4,6,8-12,14,18H,3,5,7H2,1-2H3,(H,19,20)/b6-4+,11-9+/t14-/m1/s1 |
| InChIKey | XKZQTPGPFAVCDK-NOPIEOOISA-N |
| XLogP | 3.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|