C22H31NO5S2 — CID 162815781
6-[2-[1-[(2-acetamido-2-carboxyethyl)disulfanyl]butyl]-4-methylphenyl]hex-5-enoic acid (PubChem CID 162815781) has the molecular formula C22H31NO5S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 6-[2-[1-[(2-acetamido-2-carboxyethyl)disulfanyl]butyl]-4-methylphenyl]hex-5-enoic acid.
| Compound Name | 6-[2-[1-[(2-acetamido-2-carboxyethyl)disulfanyl]butyl]-4-methylphenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 162815781 |
| Molecular Formula | C22H31NO5S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 6-[2-[1-[(2-acetamido-2-carboxyethyl)disulfanyl]butyl]-4-methylphenyl]hex-5-enoic acid |
| SMILES | CCCC(SSCC(NC(C)=O)C(=O)O)c1cc(C)ccc1C=CCCCC(=O)O |
| InChI | InChI=1S/C22H31NO5S2/c1-4-8-20(30-29-14-19(22(27)28)23-16(3)24)18-13-15(2)11-12-17(18)9-6-5-7-10-21(25)26/h6,9,11-13,19-20H,4-5,7-8,10,14H2,1-3H3,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | IZPIIKDCVJWAGQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|