C20H17F3N2 — CID 44605400
N-(4-ethylphenyl)-4-[3-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 44605400) has the molecular formula C20H17F3N2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[3-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | N-(4-ethylphenyl)-4-[3-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 44605400 |
| Molecular Formula | C20H17F3N2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-(4-ethylphenyl)-4-[3-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | CCc1ccc(Nc2cc(-c3cccc(C(F)(F)F)c3)ccn2)cc1 |
| InChI | InChI=1S/C20H17F3N2/c1-2-14-6-8-18(9-7-14)25-19-13-16(10-11-24-19)15-4-3-5-17(12-15)20(21,22)23/h3-13H,2H2,1H3,(H,24,25) |
| InChIKey | DJDJULBOSJXEKX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |