C21H19Cl2NO2 — CID 44607580
5-(2,5-dichlorophenyl)-N-(2,6-diethylphenyl)furan-2-carboxamide (PubChem CID 44607580) has the molecular formula C21H19Cl2NO2 and a molecular weight of 388.29 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-(2,6-diethylphenyl)furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-(2,6-diethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 44607580 |
| Molecular Formula | C21H19Cl2NO2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-(2,6-diethylphenyl)furan-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C21H19Cl2NO2/c1-3-13-6-5-7-14(4-2)20(13)24-21(25)19-11-10-18(26-19)16-12-15(22)8-9-17(16)23/h5-12H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | XECIGFKOOKPZGH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |