C22H19ClN2O3 — CID 59761390
5-(4-chlorophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide (PubChem CID 59761390) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 59761390 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[5-(cyclopropylcarbamoyl)-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1NC(=O)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H19ClN2O3/c1-13-2-3-15(21(26)24-17-8-9-17)12-18(13)25-22(27)20-11-10-19(28-20)14-4-6-16(23)7-5-14/h2-7,10-12,17H,8-9H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | NGKCBCQGHGQELZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |