C23H22ClN3O2 — CID 53251323
2-(4-chlorophenyl)-5-methyl-8-piperazin-1-yl-10H-furo[2,3-c][1]benzazepin-4-one (PubChem CID 53251323) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-methyl-8-piperazin-1-yl-10H-furo[2,3-c][1]benzazepin-4-one.
| Compound Name | 2-(4-chlorophenyl)-5-methyl-8-piperazin-1-yl-10H-furo[2,3-c][1]benzazepin-4-one |
|---|---|
| PubChem CID | 53251323 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-(4-chlorophenyl)-5-methyl-8-piperazin-1-yl-10H-furo[2,3-c][1]benzazepin-4-one |
| SMILES | CN1C(=O)c2oc(-c3ccc(Cl)cc3)cc2Cc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C23H22ClN3O2/c1-26-20-7-6-19(27-10-8-25-9-11-27)13-16(20)12-17-14-21(29-22(17)23(26)28)15-2-4-18(24)5-3-15/h2-7,13-14,25H,8-12H2,1H3 |
| InChIKey | SIJOROVRMMKDAO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|