C4H7O5- — CID 44607603
2-(1,2-dihydroxyethoxy)acetate (PubChem CID 44607603) has the molecular formula C4H7O5- and a molecular weight of 135.09 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethoxy)acetate.
| Compound Name | 2-(1,2-dihydroxyethoxy)acetate |
|---|---|
| PubChem CID | 44607603 |
| Molecular Formula | C4H7O5- |
| Molecular Weight | 135.09 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 2-(1,2-dihydroxyethoxy)acetate |
| SMILES | O=C([O-])COC(O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-4(8)9-2-3(6)7/h4-5,8H,1-2H2,(H,6,7)/p-1 |
| InChIKey | ZQBWCQHCMJERPW-UHFFFAOYSA-M |
| XLogP | -2.94 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.09 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|