C23H18ClFN4O2S — CID 44608592
N-[2-chloro-5-[4-(5-fluoro-1,3-dihydroisoindol-2-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 44608592) has the molecular formula C23H18ClFN4O2S and a molecular weight of 468.94 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(5-fluoro-1,3-dihydroisoindol-2-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[4-(5-fluoro-1,3-dihydroisoindol-2-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 44608592 |
| Molecular Formula | C23H18ClFN4O2S |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[2-chloro-5-[4-(5-fluoro-1,3-dihydroisoindol-2-yl)quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(-c2ccc3nccc(N4Cc5ccc(F)cc5C4)c3c2)cnc1Cl |
| InChI | InChI=1S/C23H18ClFN4O2S/c1-32(30,31)28-21-10-16(11-27-23(21)24)14-3-5-20-19(9-14)22(6-7-26-20)29-12-15-2-4-18(25)8-17(15)13-29/h2-11,28H,12-13H2,1H3 |
| InChIKey | CDKUOOSUQUAMSM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|