C18H14N2O3S — CID 44609079
methyl 4-[3-[(E)-2-thiophen-2-ylethenyl]pyrazole-1-carbonyl]benzoate (PubChem CID 44609079) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 4-[3-[(E)-2-thiophen-2-ylethenyl]pyrazole-1-carbonyl]benzoate.
| Compound Name | methyl 4-[3-[(E)-2-thiophen-2-ylethenyl]pyrazole-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 44609079 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl 4-[3-[(E)-2-thiophen-2-ylethenyl]pyrazole-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)n2ccc(/C=C/c3cccs3)n2)cc1 |
| InChI | InChI=1S/C18H14N2O3S/c1-23-18(22)14-6-4-13(5-7-14)17(21)20-11-10-15(19-20)8-9-16-3-2-12-24-16/h2-12H,1H3/b9-8+ |
| InChIKey | PLXGESFUIYJCPQ-CMDGGOBGSA-N |
| XLogP | 3.59 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |