C14H10N2OS2 — CID 66962023
thiophen-3-yl-[3-(2-thiophen-2-ylethenyl)pyrazol-1-yl]methanone (PubChem CID 66962023) has the molecular formula C14H10N2OS2 and a molecular weight of 286.38 g/mol. Its IUPAC name is thiophen-3-yl-[3-(2-thiophen-2-ylethenyl)pyrazol-1-yl]methanone.
| Compound Name | thiophen-3-yl-[3-(2-thiophen-2-ylethenyl)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 66962023 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | thiophen-3-yl-[3-(2-thiophen-2-ylethenyl)pyrazol-1-yl]methanone |
| SMILES | O=C(c1ccsc1)n1ccc(C=Cc2cccs2)n1 |
| InChI | InChI=1S/C14H10N2OS2/c17-14(11-6-9-18-10-11)16-7-5-12(15-16)3-4-13-2-1-8-19-13/h1-10H |
| InChIKey | APQORYGOLOJDIG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |