C25H22ClFN4O2S — CID 44609543
N-[2-chloro-5-(4-piperidin-1-ylquinolin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 44609543) has the molecular formula C25H22ClFN4O2S and a molecular weight of 497.00 g/mol. Its IUPAC name is N-[2-chloro-5-(4-piperidin-1-ylquinolin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-(4-piperidin-1-ylquinolin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44609543 |
| Molecular Formula | C25H22ClFN4O2S |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[2-chloro-5-(4-piperidin-1-ylquinolin-6-yl)-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3nccc(N4CCCCC4)c3c2)cnc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22ClFN4O2S/c26-25-23(30-34(32,33)20-7-5-19(27)6-8-20)15-18(16-29-25)17-4-9-22-21(14-17)24(10-11-28-22)31-12-2-1-3-13-31/h4-11,14-16,30H,1-3,12-13H2 |
| InChIKey | ZCCGGRQYWABCQX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|