C27H27ClN4O4S — CID 44610158
N-[2-chloro-5-[4-(4-methoxypiperidin-1-yl)quinolin-6-yl]-3-pyridinyl]-4-methoxybenzenesulfonamide (PubChem CID 44610158) has the molecular formula C27H27ClN4O4S and a molecular weight of 539.06 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(4-methoxypiperidin-1-yl)quinolin-6-yl]-3-pyridinyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[4-(4-methoxypiperidin-1-yl)quinolin-6-yl]-3-pyridinyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 44610158 |
| Molecular Formula | C27H27ClN4O4S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | N-[2-chloro-5-[4-(4-methoxypiperidin-1-yl)quinolin-6-yl]-3-pyridinyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(-c3ccc4nccc(N5CCC(OC)CC5)c4c3)cnc2Cl)cc1 |
| InChI | InChI=1S/C27H27ClN4O4S/c1-35-20-4-6-22(7-5-20)37(33,34)31-25-16-19(17-30-27(25)28)18-3-8-24-23(15-18)26(9-12-29-24)32-13-10-21(36-2)11-14-32/h3-9,12,15-17,21,31H,10-11,13-14H2,1-2H3 |
| InChIKey | CTQVFFHMMAUOQG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|