C18H17ClN4O5 — CID 44611564
[(3R)-3-[(3-chlorophenyl)methylamino]pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 44611564) has the molecular formula C18H17ClN4O5 and a molecular weight of 404.81 g/mol. Its IUPAC name is [(3R)-3-[(3-chlorophenyl)methylamino]pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [(3R)-3-[(3-chlorophenyl)methylamino]pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 44611564 |
| Molecular Formula | C18H17ClN4O5 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [(3R)-3-[(3-chlorophenyl)methylamino]pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CC[C@@H](NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H17ClN4O5/c19-14-3-1-2-12(6-14)10-20-15-4-5-21(11-15)18(24)13-7-16(22(25)26)9-17(8-13)23(27)28/h1-3,6-9,15,20H,4-5,10-11H2/t15-/m1/s1 |
| InChIKey | PFWUOTIIBFVXIM-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|