C18H18N4O5 — CID 75082011
[3-(benzylamino)pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 75082011) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is [3-(benzylamino)pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [3-(benzylamino)pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 75082011 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [3-(benzylamino)pyrrolidin-1-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CCC(NCc2ccccc2)C1 |
| InChI | InChI=1S/C18H18N4O5/c23-18(14-8-16(21(24)25)10-17(9-14)22(26)27)20-7-6-15(12-20)19-11-13-4-2-1-3-5-13/h1-5,8-10,15,19H,6-7,11-12H2 |
| InChIKey | DVVOZIMQNFODHN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|