C16H20N2O5 — CID 44613236
ethyl 2-(ethoxycarbonylamino)-2-(1-methyl-2-oxo-3H-indol-3-yl)acetate (PubChem CID 44613236) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 2-(ethoxycarbonylamino)-2-(1-methyl-2-oxo-3H-indol-3-yl)acetate.
| Compound Name | ethyl 2-(ethoxycarbonylamino)-2-(1-methyl-2-oxo-3H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 44613236 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 2-(ethoxycarbonylamino)-2-(1-methyl-2-oxo-3H-indol-3-yl)acetate |
| SMILES | CCOC(=O)NC(C(=O)OCC)C1C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C16H20N2O5/c1-4-22-15(20)13(17-16(21)23-5-2)12-10-8-6-7-9-11(10)18(3)14(12)19/h6-9,12-13H,4-5H2,1-3H3,(H,17,21) |
| InChIKey | XNZVDSLDAMDIPE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |