C26H19N5 — CID 44613560
12,16-bis(4-methylphenyl)-2,9,13,14,15-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaene (PubChem CID 44613560) has the molecular formula C26H19N5 and a molecular weight of 401.47 g/mol. Its IUPAC name is 12,16-bis(4-methylphenyl)-2,9,13,14,15-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaene.
| Compound Name | 12,16-bis(4-methylphenyl)-2,9,13,14,15-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaene |
|---|---|
| PubChem CID | 44613560 |
| Molecular Formula | C26H19N5 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 12,16-bis(4-methylphenyl)-2,9,13,14,15-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaene |
| SMILES | Cc1ccc(-c2nnn3c(-c4ccc(C)cc4)cc4nc5ccccc5nc4c23)cc1 |
| InChI | InChI=1S/C26H19N5/c1-16-7-11-18(12-8-16)23-15-22-25(28-21-6-4-3-5-20(21)27-22)26-24(29-30-31(23)26)19-13-9-17(2)10-14-19/h3-15H,1-2H3 |
| InChIKey | SCIMFEDIWRVBOP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|