C16H16N4 — CID 665899
1,5,5-trimethyl-2,4-dihydropyrazolo[4,3-a]phenazine (PubChem CID 665899) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1,5,5-trimethyl-2,4-dihydropyrazolo[4,3-a]phenazine.
| Compound Name | 1,5,5-trimethyl-2,4-dihydropyrazolo[4,3-a]phenazine |
|---|---|
| PubChem CID | 665899 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1,5,5-trimethyl-2,4-dihydropyrazolo[4,3-a]phenazine |
| SMILES | Cc1[nH]nc2c1-c1nc3ccccc3nc1C(C)(C)C2 |
| InChI | InChI=1S/C16H16N4/c1-9-13-12(20-19-9)8-16(2,3)15-14(13)17-10-6-4-5-7-11(10)18-15/h4-7H,8H2,1-3H3,(H,19,20) |
| InChIKey | KIKPJKHJVSIAPJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |