C13H20N4S2 — CID 44613633
4-(1,3-dithian-2-yl)-2-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 44613633) has the molecular formula C13H20N4S2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-2-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-(1,3-dithian-2-yl)-2-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 44613633 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-2-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | CN1CCN(c2nccc(C3SCCCS3)n2)CC1 |
| InChI | InChI=1S/C13H20N4S2/c1-16-5-7-17(8-6-16)13-14-4-3-11(15-13)12-18-9-2-10-19-12/h3-4,12H,2,5-10H2,1H3 |
| InChIKey | DFPLGZHPOFVFBM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |