C29H21Cl2NO5S3 — CID 44614965
[4-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 44614965) has the molecular formula C29H21Cl2NO5S3 and a molecular weight of 630.60 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3,6-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 44614965 |
| Molecular Formula | C29H21Cl2NO5S3 |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 629.00 |
| IUPAC Name | [4-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc(CCN2C(=O)/C(=C/c3ccc(OC(=O)c4sc5cc(Cl)ccc5c4Cl)cc3)SC2=S)cc1OC |
| InChI | InChI=1S/C29H21Cl2NO5S3/c1-35-21-10-5-17(13-22(21)36-2)11-12-32-27(33)24(40-29(32)38)14-16-3-7-19(8-4-16)37-28(34)26-25(31)20-9-6-18(30)15-23(20)39-26/h3-10,13-15H,11-12H2,1-2H3/b24-14- |
| InChIKey | WACHOIFFBFIUKM-OYKKKHCWSA-N |
| XLogP | 7.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|