C28H24ClNO6S2 — CID 6246205
[4-[(E)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 6246205) has the molecular formula C28H24ClNO6S2 and a molecular weight of 570.09 g/mol. Its IUPAC name is [4-[(E)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[(E)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6246205 |
| Molecular Formula | C28H24ClNO6S2 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | [4-[(E)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1ccc(CCN2C(=O)/C(=C\c3ccc(OC(=O)c4ccc(Cl)cc4)c(OC)c3)SC2=S)cc1OC |
| InChI | InChI=1S/C28H24ClNO6S2/c1-33-21-10-4-17(14-23(21)34-2)12-13-30-26(31)25(38-28(30)37)16-18-5-11-22(24(15-18)35-3)36-27(32)19-6-8-20(29)9-7-19/h4-11,14-16H,12-13H2,1-3H3/b25-16+ |
| InChIKey | KDULLCKDYBWJPD-PCLIKHOPSA-N |
| XLogP | 6.03 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|