C26H33N3O7S — CID 44615516
N,N-diethyl-4-[(E)-[2-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]benzenesulfonamide (PubChem CID 44615516) has the molecular formula C26H33N3O7S and a molecular weight of 531.63 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-[2-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(E)-[2-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44615516 |
| Molecular Formula | C26H33N3O7S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | N,N-diethyl-4-[(E)-[2-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C(O)=C2\C(=O)C(=O)N(CCCN3CCOCC3)C2c2ccco2)cc1 |
| InChI | InChI=1S/C26H33N3O7S/c1-3-28(4-2)37(33,34)20-10-8-19(9-11-20)24(30)22-23(21-7-5-16-36-21)29(26(32)25(22)31)13-6-12-27-14-17-35-18-15-27/h5,7-11,16,23,30H,3-4,6,12-15,17-18H2,1-2H3/b24-22+ |
| InChIKey | CRRXMXNHVZMONY-ZNTNEXAZSA-N |
| XLogP | 2.45 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|