C34H37ClN4O6S — CID 44618090
1-[(2R,3R)-2-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea (PubChem CID 44618090) has the molecular formula C34H37ClN4O6S and a molecular weight of 665.21 g/mol. Its IUPAC name is 1-[(2R,3R)-2-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[(2R,3R)-2-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 44618090 |
| Molecular Formula | C34H37ClN4O6S |
| Molecular Weight | 665.21 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | 1-[(2R,3R)-2-[[(4-chlorophenyl)sulfonyl-methylamino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)Cc2cc(NC(=O)Nc3cccc4ccccc34)ccc2O[C@H]1CN(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H37ClN4O6S/c1-22-19-39(23(2)21-40)33(41)18-25-17-27(36-34(42)37-30-10-6-8-24-7-4-5-9-29(24)30)13-16-31(25)45-32(22)20-38(3)46(43,44)28-14-11-26(35)12-15-28/h4-17,22-23,32,40H,18-21H2,1-3H3,(H2,36,37,42)/t22-,23+,32+/m1/s1 |
| InChIKey | CUVPKEFTAQCXRD-MODXFSQWSA-N |
| XLogP | 5.61 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.21 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |