C16H11ClF3N3O2 — CID 44621745
4-[1-[2-chloro-4-(trifluoromethyl)phenyl]-5-(hydroxymethyl)triazol-4-yl]phenol (PubChem CID 44621745) has the molecular formula C16H11ClF3N3O2 and a molecular weight of 369.73 g/mol. Its IUPAC name is 4-[1-[2-chloro-4-(trifluoromethyl)phenyl]-5-(hydroxymethyl)triazol-4-yl]phenol.
| Compound Name | 4-[1-[2-chloro-4-(trifluoromethyl)phenyl]-5-(hydroxymethyl)triazol-4-yl]phenol |
|---|---|
| PubChem CID | 44621745 |
| Molecular Formula | C16H11ClF3N3O2 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-[1-[2-chloro-4-(trifluoromethyl)phenyl]-5-(hydroxymethyl)triazol-4-yl]phenol |
| SMILES | OCc1c(-c2ccc(O)cc2)nnn1-c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H11ClF3N3O2/c17-12-7-10(16(18,19)20)3-6-13(12)23-14(8-24)15(21-22-23)9-1-4-11(25)5-2-9/h1-7,24-25H,8H2 |
| InChIKey | LRCDREMYGXDZGV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |